C16H27FO5Si — CID 11382416
(1R,2R,4R,5S,6R,9R)-5-[ditert-butyl(fluoro)silyl]oxy-4-(hydroxymethyl)-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one (PubChem CID 11382416) has the molecular formula C16H27FO5Si and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,2R,4R,5S,6R,9R)-5-[ditert-butyl(fluoro)silyl]oxy-4-(hydroxymethyl)-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one.
| Compound Name | (1R,2R,4R,5S,6R,9R)-5-[ditert-butyl(fluoro)silyl]oxy-4-(hydroxymethyl)-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one |
|---|---|
| PubChem CID | 11382416 |
| Molecular Formula | C16H27FO5Si |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (1R,2R,4R,5S,6R,9R)-5-[ditert-butyl(fluoro)silyl]oxy-4-(hydroxymethyl)-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one |
| SMILES | CC(C)(C)[Si](F)(O[C@H]1[C@@H]2OC(=O)[C@H]3[C@H](O[C@@H]1CO)[C@H]23)C(C)(C)C |
| InChI | InChI=1S/C16H27FO5Si/c1-15(2,3)23(17,16(4,5)6)22-11-8(7-18)20-12-9-10(12)14(19)21-13(9)11/h8-13,18H,7H2,1-6H3/t8-,9-,10-,11-,12-,13-/m1/s1 |
| InChIKey | HCXCTGXBYGOFME-PCEBWVJKSA-N |
| XLogP | 2.31 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|