C25H47FO5Si2 — CID 101270025
(1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-4-[tri(propan-2-yl)silyloxymethyl]-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one (PubChem CID 101270025) has the molecular formula C25H47FO5Si2 and a molecular weight of 502.82 g/mol. Its IUPAC name is (1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-4-[tri(propan-2-yl)silyloxymethyl]-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one.
| Compound Name | (1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-4-[tri(propan-2-yl)silyloxymethyl]-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one |
|---|---|
| PubChem CID | 101270025 |
| Molecular Formula | C25H47FO5Si2 |
| Molecular Weight | 502.82 g/mol |
| Exact Mass | 502.29 |
| IUPAC Name | (1R,2R,4R,5S,6R)-5-[ditert-butyl(fluoro)silyl]oxy-4-[tri(propan-2-yl)silyloxymethyl]-3,7-dioxatricyclo[4.3.0.02,9]nonan-8-one |
| SMILES | CC(C)[Si](OC[C@H]1O[C@H]2C3C(=O)O[C@@H]([C@@H]1O[Si](F)(C(C)(C)C)C(C)(C)C)[C@H]32)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H47FO5Si2/c1-14(2)32(15(3)4,16(5)6)28-13-17-20(22-18-19(21(18)29-17)23(27)30-22)31-33(26,24(7,8)9)25(10,11)12/h14-22H,13H2,1-12H3/t17-,18-,19?,20-,21-,22-/m1/s1 |
| InChIKey | LCDSTBKBZOSORI-BIUKEYNWSA-N |
| XLogP | 6.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.82 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|