C19H34O5Si2 — CID 101270023
(1S,2R,6S,7R,9R)-12,12-ditert-butyl-5-trimethylsilyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one (PubChem CID 101270023) has the molecular formula C19H34O5Si2 and a molecular weight of 398.65 g/mol. Its IUPAC name is (1S,2R,6S,7R,9R)-12,12-ditert-butyl-5-trimethylsilyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one.
| Compound Name | (1S,2R,6S,7R,9R)-12,12-ditert-butyl-5-trimethylsilyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
|---|---|
| PubChem CID | 101270023 |
| Molecular Formula | C19H34O5Si2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (1S,2R,6S,7R,9R)-12,12-ditert-butyl-5-trimethylsilyl-3,8,11,13-tetraoxa-12-silatetracyclo[7.4.0.02,6.05,7]tridecan-4-one |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H]3C4[C@@H](OC(=O)C43[Si](C)(C)C)[C@@H]2O1 |
| InChI | InChI=1S/C19H34O5Si2/c1-17(2,3)26(18(4,5)6)21-10-11-13(24-26)14-12-15(22-11)19(12,16(20)23-14)25(7,8)9/h11-15H,10H2,1-9H3/t11-,12?,13-,14-,15-,19?/m1/s1 |
| InChIKey | SPVUMOSTCKGKEO-ZQESXVECSA-N |
| XLogP | 3.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|