C18H32O6Si — CID 90839905
ethyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate (PubChem CID 90839905) has the molecular formula C18H32O6Si and a molecular weight of 372.53 g/mol. Its IUPAC name is ethyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate.
| Compound Name | ethyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
|---|---|
| PubChem CID | 90839905 |
| Molecular Formula | C18H32O6Si |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | ethyl (1R,3S,4R,5S,6R,7R)-9,9-ditert-butyl-6-hydroxy-2,8,10-trioxa-9-silatricyclo[5.4.0.03,5]undecane-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1[C@H]2O[C@@H]3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]3[C@H](O)[C@@H]21 |
| InChI | InChI=1S/C18H32O6Si/c1-8-21-16(20)12-11-13(19)14-10(23-15(11)12)9-22-25(24-14,17(2,3)4)18(5,6)7/h10-15,19H,8-9H2,1-7H3/t10-,11+,12-,13-,14+,15+/m1/s1 |
| InChIKey | MGFOGELFGPUQEE-QLKXBERHSA-N |
| XLogP | 2.38 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|