C30H58O6Si2 — CID 134969622
ethyl (1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-carboxylate (PubChem CID 134969622) has the molecular formula C30H58O6Si2 and a molecular weight of 570.96 g/mol. Its IUPAC name is ethyl (1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-carboxylate.
| Compound Name | ethyl (1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-carboxylate |
|---|---|
| PubChem CID | 134969622 |
| Molecular Formula | C30H58O6Si2 |
| Molecular Weight | 570.96 g/mol |
| Exact Mass | 570.38 |
| IUPAC Name | ethyl (1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@]1(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O1)O2 |
| InChI | InChI=1S/C30H58O6Si2/c1-16-32-26(31)29-17-22(29)25(35-38(14,15)28(9,10)11)21(5)30(36-29)18-23(20(4)24(33-30)19(2)3)34-37(12,13)27(6,7)8/h19-25H,16-18H2,1-15H3/t20-,21-,22-,23+,24+,25-,29-,30-/m0/s1 |
| InChIKey | IXPITEOHDGZPDC-ARJBPAKCSA-N |
| XLogP | 7.53 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.96 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|