C24H44O9Si2 — CID 10626107
1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate (PubChem CID 10626107) has the molecular formula C24H44O9Si2 and a molecular weight of 532.78 g/mol. Its IUPAC name is 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate.
| Compound Name | 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 10626107 |
| Molecular Formula | C24H44O9Si2 |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 1-O-ethyl 7-O-methyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@@](C)(O[C@@H]1C(=O)OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C2=O |
| InChI | InChI=1S/C24H44O9Si2/c1-14-29-20(27)24-16(25)15(31-34(10,11)21(2,3)4)17(32-35(12,13)22(5,6)7)23(8,33-24)30-18(24)19(26)28-9/h15,17-18H,14H2,1-13H3/t15-,17+,18+,23+,24-/m0/s1 |
| InChIKey | WDOPZFRWNCFTOU-UYIXATTHSA-N |
| XLogP | 3.96 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|