C27H50O9Si2 — CID 10531212
7-O-tert-butyl 1-O-ethyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate (PubChem CID 10531212) has the molecular formula C27H50O9Si2 and a molecular weight of 574.86 g/mol. Its IUPAC name is 7-O-tert-butyl 1-O-ethyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate.
| Compound Name | 7-O-tert-butyl 1-O-ethyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
|---|---|
| PubChem CID | 10531212 |
| Molecular Formula | C27H50O9Si2 |
| Molecular Weight | 574.86 g/mol |
| Exact Mass | 574.30 |
| IUPAC Name | 7-O-tert-butyl 1-O-ethyl (1R,3R,4R,5R,7S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-methyl-2-oxo-6,8-dioxabicyclo[3.2.1]octane-1,7-dicarboxylate |
| SMILES | CCOC(=O)[C@@]12O[C@@](C)(O[C@@H]1C(=O)OC(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C2=O |
| InChI | InChI=1S/C27H50O9Si2/c1-16-31-22(30)27-18(28)17(34-37(12,13)24(5,6)7)19(35-38(14,15)25(8,9)10)26(11,36-27)32-20(27)21(29)33-23(2,3)4/h17,19-20H,16H2,1-15H3/t17-,19+,20+,26+,27-/m0/s1 |
| InChIKey | RTDNYFVVEJZAJC-HGLQJSDESA-N |
| XLogP | 5.13 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|