C29H56O5Si2 — CID 11827661
1-[(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]ethanone (PubChem CID 11827661) has the molecular formula C29H56O5Si2 and a molecular weight of 540.93 g/mol. Its IUPAC name is 1-[(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]ethanone.
| Compound Name | 1-[(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]ethanone |
|---|---|
| PubChem CID | 11827661 |
| Molecular Formula | C29H56O5Si2 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 1-[(1S,3S,4S,4'R,5R,5'R,6S,6'R)-4',5-bis[[tert-butyl(dimethyl)silyl]oxy]-4,5'-dimethyl-6'-propan-2-ylspiro[2-oxabicyclo[4.1.0]heptane-3,2'-oxane]-1-yl]ethanone |
| SMILES | CC(=O)[C@]12C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@]1(C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](C(C)C)O1)O2 |
| InChI | InChI=1S/C29H56O5Si2/c1-18(2)24-19(3)23(32-35(12,13)26(6,7)8)17-29(31-24)20(4)25(33-36(14,15)27(9,10)11)22-16-28(22,34-29)21(5)30/h18-20,22-25H,16-17H2,1-15H3/t19-,20-,22-,23+,24+,25-,28+,29-/m0/s1 |
| InChIKey | ATPDHQJLXANITN-WJPHAZSISA-N |
| XLogP | 7.56 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|