C23H40O6Si — CID 11212852
(1R,3S,8R,11S,13R,15S,16R,18S)-15-[tert-butyl(dimethyl)silyl]oxy-3,16-dimethyl-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-6-one (PubChem CID 11212852) has the molecular formula C23H40O6Si and a molecular weight of 440.65 g/mol. Its IUPAC name is (1R,3S,8R,11S,13R,15S,16R,18S)-15-[tert-butyl(dimethyl)silyl]oxy-3,16-dimethyl-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-6-one.
| Compound Name | (1R,3S,8R,11S,13R,15S,16R,18S)-15-[tert-butyl(dimethyl)silyl]oxy-3,16-dimethyl-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-6-one |
|---|---|
| PubChem CID | 11212852 |
| Molecular Formula | C23H40O6Si |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | (1R,3S,8R,11S,13R,15S,16R,18S)-15-[tert-butyl(dimethyl)silyl]oxy-3,16-dimethyl-2,7,12,17-tetraoxatetracyclo[9.8.0.03,8.013,18]nonadecan-6-one |
| SMILES | C[C@H]1O[C@H]2C[C@H]3O[C@@]4(C)CCC(=O)O[C@@H]4CC[C@@H]3O[C@@H]2C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H40O6Si/c1-14-16(29-30(6,7)22(2,3)4)12-18-17(25-14)13-19-15(26-18)8-9-20-23(5,28-19)11-10-21(24)27-20/h14-20H,8-13H2,1-7H3/t14-,15+,16+,17+,18-,19-,20-,23+/m1/s1 |
| InChIKey | CPVWZOXQIASIJF-UGZKDTGNSA-N |
| XLogP | 4.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|