C19H36O6Si — CID 158001175
(3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butanoic acid (PubChem CID 158001175) has the molecular formula C19H36O6Si and a molecular weight of 388.58 g/mol. Its IUPAC name is (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butanoic acid.
| Compound Name | (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butanoic acid |
|---|---|
| PubChem CID | 158001175 |
| Molecular Formula | C19H36O6Si |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (3S)-3-[(6S,7S,8aR)-2,2-ditert-butyl-7-methoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-6-yl]butanoic acid |
| SMILES | CO[C@H]1C[C@H]2O[Si](C(C)(C)C)(C(C)(C)C)OCC2O[C@H]1[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C19H36O6Si/c1-12(9-16(20)21)17-14(22-8)10-13-15(24-17)11-23-26(25-13,18(2,3)4)19(5,6)7/h12-15,17H,9-11H2,1-8H3,(H,20,21)/t12-,13+,14-,15?,17-/m0/s1 |
| InChIKey | FDTGYOJGCGAMGW-JAAYERJMSA-N |
| XLogP | 3.73 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|