C23H42O5Si — CID 135068618
(1S,3S,8R,11R,14R)-1,8,13,13-tetramethyl-14-triethylsilyloxy-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one (PubChem CID 135068618) has the molecular formula C23H42O5Si and a molecular weight of 426.67 g/mol. Its IUPAC name is (1S,3S,8R,11R,14R)-1,8,13,13-tetramethyl-14-triethylsilyloxy-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one.
| Compound Name | (1S,3S,8R,11R,14R)-1,8,13,13-tetramethyl-14-triethylsilyloxy-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one |
|---|---|
| PubChem CID | 135068618 |
| Molecular Formula | C23H42O5Si |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.28 |
| IUPAC Name | (1S,3S,8R,11R,14R)-1,8,13,13-tetramethyl-14-triethylsilyloxy-2,7,12-trioxatricyclo[9.5.0.03,8]hexadecan-6-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC[C@]2(C)O[C@H]3CCC(=O)O[C@]3(C)CC[C@H]2OC1(C)C |
| InChI | InChI=1S/C23H42O5Si/c1-8-29(9-2,10-3)28-17-13-15-22(6)19(25-21(17,4)5)14-16-23(7)18(26-22)11-12-20(24)27-23/h17-19H,8-16H2,1-7H3/t17-,18+,19-,22+,23-/m1/s1 |
| InChIKey | WJXSYBKQBKVIRN-KNEUARKQSA-N |
| XLogP | 5.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|