C19H38O4Si — CID 157339137
(3S)-3-[(2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-propyloxan-2-yl]butanoic acid (PubChem CID 157339137) has the molecular formula C19H38O4Si and a molecular weight of 358.60 g/mol. Its IUPAC name is (3S)-3-[(2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-propyloxan-2-yl]butanoic acid.
| Compound Name | (3S)-3-[(2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-propyloxan-2-yl]butanoic acid |
|---|---|
| PubChem CID | 157339137 |
| Molecular Formula | C19H38O4Si |
| Molecular Weight | 358.60 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (3S)-3-[(2S,3S,5R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-6-propyloxan-2-yl]butanoic acid |
| SMILES | CCC[C@H]1O[C@@H]([C@@H](C)CC(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C |
| InChI | InChI=1S/C19H38O4Si/c1-9-10-15-13(2)11-16(23-24(7,8)19(4,5)6)18(22-15)14(3)12-17(20)21/h13-16,18H,9-12H2,1-8H3,(H,20,21)/t13-,14+,15-,16+,18+/m1/s1 |
| InChIKey | CZJYWLQJCHVGGI-OCABDXPQSA-N |
| XLogP | 5.08 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.60 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|