C14H28O4Si — CID 134882512
3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propanoic acid (PubChem CID 134882512) has the molecular formula C14H28O4Si and a molecular weight of 288.46 g/mol. Its IUPAC name is 3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propanoic acid.
| Compound Name | 3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 134882512 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCCO[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C14H28O4Si/c1-14(2,3)19(4,5)18-12-7-6-10-17-11(12)8-9-13(15)16/h11-12H,6-10H2,1-5H3,(H,15,16)/t11-,12+/m1/s1 |
| InChIKey | MYADUHFQEYTDMA-NEPJUHHUSA-N |
| XLogP | 3.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|