C14H26O5Si — CID 91026521
3-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]propanoic acid (PubChem CID 91026521) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is 3-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]propanoic acid.
| Compound Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]propanoic acid |
|---|---|
| PubChem CID | 91026521 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 3-[4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=O)OC(CCC(=O)O)C1 |
| InChI | InChI=1S/C14H26O5Si/c1-14(2,3)20(4,5)19-11-8-10(6-7-12(15)16)18-13(17)9-11/h10-11H,6-9H2,1-5H3,(H,15,16) |
| InChIKey | HWBBMMLDXFANKX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|