C32H62O6Si2 — CID 24851042
2-[(4R,6R,8R,10S,13R)-13-methyl-13-triethylsilyloxy-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde (PubChem CID 24851042) has the molecular formula C32H62O6Si2 and a molecular weight of 599.01 g/mol. Its IUPAC name is 2-[(4R,6R,8R,10S,13R)-13-methyl-13-triethylsilyloxy-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde.
| Compound Name | 2-[(4R,6R,8R,10S,13R)-13-methyl-13-triethylsilyloxy-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde |
|---|---|
| PubChem CID | 24851042 |
| Molecular Formula | C32H62O6Si2 |
| Molecular Weight | 599.01 g/mol |
| Exact Mass | 598.41 |
| IUPAC Name | 2-[(4R,6R,8R,10S,13R)-13-methyl-13-triethylsilyloxy-4-[2-tri(propan-2-yl)silyloxyethyl]-5,7,9-trioxadispiro[5.1.58.26]pentadecan-10-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@@H](CC=O)O[C@@]12CC[C@@]1(CCC[C@H](CCO[Si](C(C)C)(C(C)C)C(C)C)O1)O2 |
| InChI | InChI=1S/C32H62O6Si2/c1-11-39(12-2,13-3)38-30(10)20-16-29(17-23-33)36-32(30)22-21-31(37-32)19-14-15-28(35-31)18-24-34-40(25(4)5,26(6)7)27(8)9/h23,25-29H,11-22,24H2,1-10H3/t28-,29+,30-,31-,32-/m1/s1 |
| InChIKey | CIJXGAWEMDDIPU-MTJHJEBASA-N |
| XLogP | 8.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.01 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|