C32H64O5Si2 — CID 11813931
(2S,3S,6R,8S,9R)-8-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one (PubChem CID 11813931) has the molecular formula C32H64O5Si2 and a molecular weight of 585.03 g/mol. Its IUPAC name is (2S,3S,6R,8S,9R)-8-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one.
| Compound Name | (2S,3S,6R,8S,9R)-8-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one |
|---|---|
| PubChem CID | 11813931 |
| Molecular Formula | C32H64O5Si2 |
| Molecular Weight | 585.03 g/mol |
| Exact Mass | 584.43 |
| IUPAC Name | (2S,3S,6R,8S,9R)-8-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pentyl]-2-[(2R)-2-[tert-butyl(dimethyl)silyl]oxypropyl]-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-10-one |
| SMILES | CC[C@H](CC[C@@H]1O[C@]2(CC[C@H](C)[C@H](C[C@@H](C)O[Si](C)(C)C(C)(C)C)O2)CC(=O)[C@@H]1C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H64O5Si2/c1-15-26(22-34-38(11,12)30(5,6)7)16-17-28-25(4)27(33)21-32(35-28)19-18-23(2)29(36-32)20-24(3)37-39(13,14)31(8,9)10/h23-26,28-29H,15-22H2,1-14H3/t23-,24+,25-,26+,28-,29-,32-/m0/s1 |
| InChIKey | QYUSSHWZGBGFSU-PBAJCTKYSA-N |
| XLogP | 9.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.03 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|