C32H60O7Si2 — CID 157141482
1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one (PubChem CID 157141482) has the molecular formula C32H60O7Si2 and a molecular weight of 613.00 g/mol. Its IUPAC name is 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one.
| Compound Name | 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one |
|---|---|
| PubChem CID | 157141482 |
| Molecular Formula | C32H60O7Si2 |
| Molecular Weight | 613.00 g/mol |
| Exact Mass | 612.39 |
| IUPAC Name | 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-4',14-dimethyl-3'-triethylsilyloxyspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@H](CC(C)=O)O[C@]2(C[C@H](C)[C@@H]3O[C@@H]4CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]4C[C@@H]3O2)C[C@@H]1C |
| InChI | InChI=1S/C32H60O7Si2/c1-13-40(14-2,15-3)39-29-22(5)19-32(36-25(29)16-23(6)33)18-21(4)28-26(37-32)17-24-27(35-28)20-34-41(38-24,30(7,8)9)31(10,11)12/h21-22,24-29H,13-20H2,1-12H3/t21-,22-,24+,25-,26-,27+,28-,29-,32-/m0/s1 |
| InChIKey | AKFWOCCUFLNTIZ-FKMSQGEWSA-N |
| XLogP | 7.52 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.00 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|