C27H48O6Si — CID 161100139
1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3',4',14-trimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one (PubChem CID 161100139) has the molecular formula C27H48O6Si and a molecular weight of 496.76 g/mol. Its IUPAC name is 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3',4',14-trimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one.
| Compound Name | 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3',4',14-trimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one |
|---|---|
| PubChem CID | 161100139 |
| Molecular Formula | C27H48O6Si |
| Molecular Weight | 496.76 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | 1-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3',4',14-trimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1O[C@@]2(C[C@H](C)[C@@H]1C)C[C@H](C)[C@@H]1O[C@@H]3CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]3C[C@@H]1O2 |
| InChI | InChI=1S/C27H48O6Si/c1-16-13-27(31-20(19(16)4)11-18(3)28)14-17(2)24-22(32-27)12-21-23(30-24)15-29-34(33-21,25(5,6)7)26(8,9)10/h16-17,19-24H,11-15H2,1-10H3/t16-,17-,19-,20-,21+,22-,23+,24-,27+/m0/s1 |
| InChIKey | UIHSKFCMADDFCN-ZWDBFGIPSA-N |
| XLogP | 5.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.76 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|