C25H44O8Si — CID 157445872
2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3'-hydroxy-4',14-dimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid (PubChem CID 157445872) has the molecular formula C25H44O8Si and a molecular weight of 500.71 g/mol. Its IUPAC name is 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3'-hydroxy-4',14-dimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid.
| Compound Name | 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3'-hydroxy-4',14-dimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid |
|---|---|
| PubChem CID | 157445872 |
| Molecular Formula | C25H44O8Si |
| Molecular Weight | 500.71 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[(1S,2'S,3R,3'S,4'S,8R,10S,12R,14S)-6,6-ditert-butyl-3'-hydroxy-4',14-dimethylspiro[2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecane-12,6'-oxane]-2'-yl]acetic acid |
| SMILES | C[C@H]1C[C@@]2(C[C@H](C)[C@@H]3O[C@@H]4CO[Si](C(C)(C)C)(C(C)(C)C)O[C@@H]4C[C@@H]3O2)O[C@@H](CC(=O)O)[C@H]1O |
| InChI | InChI=1S/C25H44O8Si/c1-14-11-25(31-17(21(14)28)10-20(26)27)12-15(2)22-18(32-25)9-16-19(30-22)13-29-34(33-16,23(3,4)5)24(6,7)8/h14-19,21-22,28H,9-13H2,1-8H3,(H,26,27)/t14-,15-,16+,17-,18-,19+,21-,22-,25+/m0/s1 |
| InChIKey | FPZBDJSSHUSDSE-QUFBWPSISA-N |
| XLogP | 3.98 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|