C31H54O10Si — CID 134882617
[(1R,3R,5S,6R,8S,10R,12S,14S)-12-acetyloxy-14-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-1-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-yl] 2,2-dimethylpropanoate (PubChem CID 134882617) has the molecular formula C31H54O10Si and a molecular weight of 614.85 g/mol. Its IUPAC name is [(1R,3R,5S,6R,8S,10R,12S,14S)-12-acetyloxy-14-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-1-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1R,3R,5S,6R,8S,10R,12S,14S)-12-acetyloxy-14-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-1-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134882617 |
| Molecular Formula | C31H54O10Si |
| Molecular Weight | 614.85 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | [(1R,3R,5S,6R,8S,10R,12S,14S)-12-acetyloxy-14-[tert-butyl(dimethyl)silyl]oxy-6-(1-hydroxy-3,3-dimethyl-2-oxobutyl)-1-methyl-2,7,11-trioxatricyclo[8.4.0.03,8]tetradecan-5-yl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@]2(C)O[C@@H]3C[C@H](OC(=O)C(C)(C)C)[C@@H](C(O)C(=O)C(C)(C)C)O[C@H]3C[C@H]2O1 |
| InChI | InChI=1S/C31H54O10Si/c1-17(32)36-23-16-22(41-42(12,13)30(8,9)10)31(11)21(39-23)15-18-19(40-31)14-20(38-27(35)29(5,6)7)25(37-18)24(33)26(34)28(2,3)4/h18-25,33H,14-16H2,1-13H3/t18-,19+,20-,21+,22-,23+,24?,25-,31+/m0/s1 |
| InChIKey | HXFBLYKEQXPTNZ-LFTNWLDJSA-N |
| XLogP | 4.69 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|