C22H42O8Si — CID 11070615
methyl (4S,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylate (PubChem CID 11070615) has the molecular formula C22H42O8Si and a molecular weight of 462.66 g/mol. Its IUPAC name is methyl (4S,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylate.
| Compound Name | methyl (4S,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylate |
|---|---|
| PubChem CID | 11070615 |
| Molecular Formula | C22H42O8Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | methyl (4S,4aS,6R,8S,8aR)-6-[(2S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methoxypropyl]-8-methoxy-7,7-dimethyl-4a,6,8,8a-tetrahydro-4H-pyrano[3,2-d][1,3]dioxine-4-carboxylate |
| SMILES | COC(=O)[C@H]1OCO[C@H]2[C@@H]1O[C@H](C[C@@H](CO[Si](C)(C)C(C)(C)C)OC)C(C)(C)[C@@H]2OC |
| InChI | InChI=1S/C22H42O8Si/c1-21(2,3)31(9,10)29-12-14(24-6)11-15-22(4,5)19(25-7)17-16(30-15)18(20(23)26-8)28-13-27-17/h14-19H,11-13H2,1-10H3/t14-,15+,16-,17-,18-,19+/m0/s1 |
| InChIKey | XHGKESPTJUPCKA-CABLIKTCSA-N |
| XLogP | 3.14 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|