C20H34O8Si — CID 10502767
(4R,4aR,6R,8aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,7-dimethyl-6-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one (PubChem CID 10502767) has the molecular formula C20H34O8Si and a molecular weight of 430.57 g/mol. Its IUPAC name is (4R,4aR,6R,8aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,7-dimethyl-6-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one.
| Compound Name | (4R,4aR,6R,8aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,7-dimethyl-6-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one |
|---|---|
| PubChem CID | 10502767 |
| Molecular Formula | C20H34O8Si |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (4R,4aR,6R,8aS)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-7,7-dimethyl-6-[[(4S)-2-oxo-1,3-dioxolan-4-yl]methyl]-4,4a,6,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-one |
| SMILES | CC1(C)C(=O)[C@H]2OCO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2O[C@@H]1C[C@H]1COC(=O)O1 |
| InChI | InChI=1S/C20H34O8Si/c1-19(2,3)29(6,7)26-10-13-15-16(25-11-24-13)17(21)20(4,5)14(28-15)8-12-9-23-18(22)27-12/h12-16H,8-11H2,1-7H3/t12-,13+,14+,15+,16-/m0/s1 |
| InChIKey | RZTDLUBWEYMFRP-GCSSGZNBSA-N |
| XLogP | 3.04 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|