C27H46O8Si — CID 10907512
(1S,3R,5R,7R,9S,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5,8,8,14-tetramethyl-4,11-dioxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-9-carbaldehyde (PubChem CID 10907512) has the molecular formula C27H46O8Si and a molecular weight of 526.74 g/mol. Its IUPAC name is (1S,3R,5R,7R,9S,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5,8,8,14-tetramethyl-4,11-dioxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-9-carbaldehyde.
| Compound Name | (1S,3R,5R,7R,9S,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5,8,8,14-tetramethyl-4,11-dioxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-9-carbaldehyde |
|---|---|
| PubChem CID | 10907512 |
| Molecular Formula | C27H46O8Si |
| Molecular Weight | 526.74 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | (1S,3R,5R,7R,9S,13S,14S,15S)-15-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5,8,8,14-tetramethyl-4,11-dioxo-10,17,18-trioxatricyclo[11.3.1.13,7]octadecane-9-carbaldehyde |
| SMILES | CO[C@@]12C[C@@H]3C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@H](CC(=O)O[C@H](C=O)C(C)(C)[C@@H](C[C@@H](C)C1=O)O2)O3 |
| InChI | InChI=1S/C27H46O8Si/c1-16-11-21-26(6,7)22(15-28)33-23(29)13-19-17(2)20(35-36(9,10)25(3,4)5)12-18(32-19)14-27(31-8,34-21)24(16)30/h15-22H,11-14H2,1-10H3/t16-,17+,18+,19+,20+,21-,22-,27-/m1/s1 |
| InChIKey | VFTXQSBNJPXXNU-FTRRZBHVSA-N |
| XLogP | 4.44 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.74 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|