C24H46O6Si — CID 11123372
(2R)-2-[(4R,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-(oxan-2-yloxy)butanal (PubChem CID 11123372) has the molecular formula C24H46O6Si and a molecular weight of 458.71 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-(oxan-2-yloxy)butanal.
| Compound Name | (2R)-2-[(4R,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-(oxan-2-yloxy)butanal |
|---|---|
| PubChem CID | 11123372 |
| Molecular Formula | C24H46O6Si |
| Molecular Weight | 458.71 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | (2R)-2-[(4R,5S,6R)-6-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]-4-(oxan-2-yloxy)butanal |
| SMILES | C[C@@H]1[C@H]([C@H](C=O)CCOC2CCCCO2)OC(C)(C)O[C@@H]1CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46O6Si/c1-18-20(13-16-28-31(7,8)23(2,3)4)29-24(5,6)30-22(18)19(17-25)12-15-27-21-11-9-10-14-26-21/h17-22H,9-16H2,1-8H3/t18-,19-,20+,21?,22+/m0/s1 |
| InChIKey | PVNGXENDWRKLDV-GALMUBKZSA-N |
| XLogP | 5.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.71 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|