C27H52O6Si — CID 11260555
2-[(4R,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde (PubChem CID 11260555) has the molecular formula C27H52O6Si and a molecular weight of 500.79 g/mol. Its IUPAC name is 2-[(4R,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde.
| Compound Name | 2-[(4R,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 11260555 |
| Molecular Formula | C27H52O6Si |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.35 |
| IUPAC Name | 2-[(4R,6S)-6-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-2,2-dimethyl-4-pentyl-1,3-dioxan-5-yl]ethyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetaldehyde |
| SMILES | CCCCC[C@H]1OC(C)(C)OC[C@H]1[C@H](C[C@@H]1C[C@H](CC=O)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O6Si/c1-11-12-13-14-23-22(19-29-26(5,6)32-23)24(33-34(9,10)25(2,3)4)18-21-17-20(15-16-28)30-27(7,8)31-21/h16,20-24H,11-15,17-19H2,1-10H3/t20-,21-,22+,23+,24-/m0/s1 |
| InChIKey | DJBNQSFKKUDTDQ-FCUGFLGKSA-N |
| XLogP | 6.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|