C21H38O5Si — CID 159911411
2-[(1S,3R,8R,10S,12S,13R,14R)-6,6-ditert-butyl-13,14-dimethyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde (PubChem CID 159911411) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is 2-[(1S,3R,8R,10S,12S,13R,14R)-6,6-ditert-butyl-13,14-dimethyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde.
| Compound Name | 2-[(1S,3R,8R,10S,12S,13R,14R)-6,6-ditert-butyl-13,14-dimethyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde |
|---|---|
| PubChem CID | 159911411 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | 2-[(1S,3R,8R,10S,12S,13R,14R)-6,6-ditert-butyl-13,14-dimethyl-2,5,7,11-tetraoxa-6-silatricyclo[8.4.0.03,8]tetradecan-12-yl]acetaldehyde |
| SMILES | C[C@@H]1[C@@H](C)[C@H](CC=O)O[C@H]2C[C@H]3O[Si](C(C)(C)C)(C(C)(C)C)OC[C@H]3O[C@@H]12 |
| InChI | InChI=1S/C21H38O5Si/c1-13-14(2)19-17(24-15(13)9-10-22)11-16-18(25-19)12-23-27(26-16,20(3,4)5)21(6,7)8/h10,13-19H,9,11-12H2,1-8H3/t13-,14-,15+,16-,17+,18-,19+/m1/s1 |
| InChIKey | NXFMLWMFUANFMT-FUIGDMOMSA-N |
| XLogP | 4.23 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|