C33H64O8Si2 — CID 10532222
tert-butyl 2-[(2R,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3S)-3-methyl-2-oxo-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate (PubChem CID 10532222) has the molecular formula C33H64O8Si2 and a molecular weight of 645.04 g/mol. Its IUPAC name is tert-butyl 2-[(2R,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3S)-3-methyl-2-oxo-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate.
| Compound Name | tert-butyl 2-[(2R,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3S)-3-methyl-2-oxo-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
|---|---|
| PubChem CID | 10532222 |
| Molecular Formula | C33H64O8Si2 |
| Molecular Weight | 645.04 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | tert-butyl 2-[(2R,4S,6S,8R,10S)-10-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-4-methyl-2-[(3S)-3-methyl-2-oxo-4-triethylsilyloxybutyl]-1,7-dioxaspiro[5.5]undecan-8-yl]acetate |
| SMILES | CC[Si](CC)(CC)OC[C@H](C)C(=O)C[C@H]1C[C@](C)(O)C[C@@]2(C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H](CC(=O)OC(C)(C)C)O2)O1 |
| InChI | InChI=1S/C33H64O8Si2/c1-14-43(15-2,16-3)37-22-24(4)28(34)18-26-20-32(11,36)23-33(39-26)21-27(41-42(12,13)31(8,9)10)17-25(38-33)19-29(35)40-30(5,6)7/h24-27,36H,14-23H2,1-13H3/t24-,25+,26-,27-,32-,33+/m0/s1 |
| InChIKey | YSTTWSBKAIIAOQ-GDVMBWGDSA-N |
| XLogP | 7.53 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.04 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|