C16H32O5Si — CID 11667114
[(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxoheptyl] acetate (PubChem CID 11667114) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxoheptyl] acetate.
| Compound Name | [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxoheptyl] acetate |
|---|---|
| PubChem CID | 11667114 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-oxoheptyl] acetate |
| SMILES | CO[C@@H](CC=O)[C@H](CCCOC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-13(18)20-12-8-9-15(14(19-5)10-11-17)21-22(6,7)16(2,3)4/h11,14-15H,8-10,12H2,1-7H3/t14-,15-/m0/s1 |
| InChIKey | FTCFVIIAMLKKOU-GJZGRUSLSA-N |
| XLogP | 3.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|