C30H66O4Si3 — CID 11157426
(3S,5R,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-3-tri(propan-2-yl)silyloxyheptanal (PubChem CID 11157426) has the molecular formula C30H66O4Si3 and a molecular weight of 575.11 g/mol. Its IUPAC name is (3S,5R,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-3-tri(propan-2-yl)silyloxyheptanal.
| Compound Name | (3S,5R,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-3-tri(propan-2-yl)silyloxyheptanal |
|---|---|
| PubChem CID | 11157426 |
| Molecular Formula | C30H66O4Si3 |
| Molecular Weight | 575.11 g/mol |
| Exact Mass | 574.43 |
| IUPAC Name | (3S,5R,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dimethyl-3-tri(propan-2-yl)silyloxyheptanal |
| SMILES | CC(C)[Si](O[C@H](CC=O)C[C@@](C)(O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H66O4Si3/c1-23(2)37(24(3)4,25(5)6)33-27(19-20-31)21-30(14,34-36(17,18)29(11,12)13)26(7)22-32-35(15,16)28(8,9)10/h20,23-27H,19,21-22H2,1-18H3/t26-,27+,30+/m0/s1 |
| InChIKey | ULYFRWPWADWXOO-PVTPYKNESA-N |
| XLogP | 9.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.11 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|