C12H24O4Si — CID 101137711
(2S)-3-[(2S,3S,5R)-5-methoxy-3-trimethylsilyloxyoxolan-2-yl]-2-methylpropanal (PubChem CID 101137711) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is (2S)-3-[(2S,3S,5R)-5-methoxy-3-trimethylsilyloxyoxolan-2-yl]-2-methylpropanal.
| Compound Name | (2S)-3-[(2S,3S,5R)-5-methoxy-3-trimethylsilyloxyoxolan-2-yl]-2-methylpropanal |
|---|---|
| PubChem CID | 101137711 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S)-3-[(2S,3S,5R)-5-methoxy-3-trimethylsilyloxyoxolan-2-yl]-2-methylpropanal |
| SMILES | CO[C@H]1C[C@H](O[Si](C)(C)C)[C@H](C[C@H](C)C=O)O1 |
| InChI | InChI=1S/C12H24O4Si/c1-9(8-13)6-10-11(16-17(3,4)5)7-12(14-2)15-10/h8-12H,6-7H2,1-5H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | ODYWODPUNHTDGJ-FIQHERPVSA-N |
| XLogP | 2.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|