C28H56O7Si2 — CID 102392250
4-O-[(4R)-4-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate (PubChem CID 102392250) has the molecular formula C28H56O7Si2 and a molecular weight of 560.92 g/mol. Its IUPAC name is 4-O-[(4R)-4-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[(4R)-4-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 102392250 |
| Molecular Formula | C28H56O7Si2 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | 4-O-[(4R)-4-[(1S)-1,2-bis(triethylsilyloxy)ethyl]-1-oxooctan-4-yl] 1-O-ethyl butanedioate |
| SMILES | CCCC[C@](CCC=O)(OC(=O)CCC(=O)OCC)[C@H](CO[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C28H56O7Si2/c1-9-17-21-28(22-18-23-29,34-27(31)20-19-26(30)32-10-2)25(35-37(14-6,15-7)16-8)24-33-36(11-3,12-4)13-5/h23,25H,9-22,24H2,1-8H3/t25-,28+/m0/s1 |
| InChIKey | XPHZHIUUEUHMQI-LBNVMWSVSA-N |
| XLogP | 7.19 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|