C22H42O5Si — CID 178184687
3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxobutyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 178184687) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxobutyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxobutyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178184687 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxobutyl)oxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCC=O)O1 |
| InChI | InChI=1S/C22H42O5Si/c1-21(2,3)20(24)25-15-11-12-17-16-19(18(26-17)13-9-10-14-23)27-28(7,8)22(4,5)6/h14,17-19H,9-13,15-16H2,1-8H3/t17-,18-,19-/m0/s1 |
| InChIKey | DYHIXKQUWJNBMC-FHWLQOOXSA-N |
| XLogP | 5.27 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|