C22H41ClO5Si — CID 178184691
3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-3-chloro-4-oxobutyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 178184691) has the molecular formula C22H41ClO5Si and a molecular weight of 449.10 g/mol. Its IUPAC name is 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-3-chloro-4-oxobutyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-3-chloro-4-oxobutyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178184691 |
| Molecular Formula | C22H41ClO5Si |
| Molecular Weight | 449.10 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S)-3-chloro-4-oxobutyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC[C@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC[C@H](Cl)C=O)O1 |
| InChI | InChI=1S/C22H41ClO5Si/c1-21(2,3)20(25)26-13-9-10-17-14-19(28-29(7,8)22(4,5)6)18(27-17)12-11-16(23)15-24/h15-19H,9-14H2,1-8H3/t16-,17-,18-,19-/m0/s1 |
| InChIKey | SZUDJHYKBCHPCF-VJANTYMQSA-N |
| XLogP | 5.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.10 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|