C26H49ClO5Si — CID 178184692
3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-chloro-5-methyl-6-oxoheptyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 178184692) has the molecular formula C26H49ClO5Si and a molecular weight of 505.21 g/mol. Its IUPAC name is 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-chloro-5-methyl-6-oxoheptyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-chloro-5-methyl-6-oxoheptyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 178184692 |
| Molecular Formula | C26H49ClO5Si |
| Molecular Weight | 505.21 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 3-[(2S,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3S,5R)-3-chloro-5-methyl-6-oxoheptyl]oxolan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)[C@H](C)C[C@@H](Cl)CC[C@@H]1O[C@@H](CCCOC(=O)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H49ClO5Si/c1-18(19(2)28)16-20(27)13-14-22-23(32-33(9,10)26(6,7)8)17-21(31-22)12-11-15-30-24(29)25(3,4)5/h18,20-23H,11-17H2,1-10H3/t18-,20+,21+,22+,23+/m1/s1 |
| InChIKey | ZUXKFKKHWGTXAW-PMAMDCHESA-N |
| XLogP | 6.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.21 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|