C17H28O5Si — CID 134838118
1-(7-acetyl-1,5-dimethyl-6-trimethylsilyloxy-9,10-dioxatricyclo[4.2.1.12,5]decan-3-yl)ethanone (PubChem CID 134838118) has the molecular formula C17H28O5Si and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-(7-acetyl-1,5-dimethyl-6-trimethylsilyloxy-9,10-dioxatricyclo[4.2.1.12,5]decan-3-yl)ethanone.
| Compound Name | 1-(7-acetyl-1,5-dimethyl-6-trimethylsilyloxy-9,10-dioxatricyclo[4.2.1.12,5]decan-3-yl)ethanone |
|---|---|
| PubChem CID | 134838118 |
| Molecular Formula | C17H28O5Si |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-(7-acetyl-1,5-dimethyl-6-trimethylsilyloxy-9,10-dioxatricyclo[4.2.1.12,5]decan-3-yl)ethanone |
| SMILES | CC(=O)C1CC2(C)OC1C1(C)CC(C(C)=O)C2(O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C17H28O5Si/c1-10(18)12-8-16(4)17(22-23(5,6)7)13(11(2)19)9-15(3,21-17)14(12)20-16/h12-14H,8-9H2,1-7H3 |
| InChIKey | GPFJDKHSSZIZQI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|