C25H52O4Si2 — CID 135025581
1-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone (PubChem CID 135025581) has the molecular formula C25H52O4Si2 and a molecular weight of 472.86 g/mol. Its IUPAC name is 1-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone.
| Compound Name | 1-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone |
|---|---|
| PubChem CID | 135025581 |
| Molecular Formula | C25H52O4Si2 |
| Molecular Weight | 472.86 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | 1-[(2R,5R,6R)-5-methyl-5-triethylsilyloxy-6-[2-tri(propan-2-yl)silyloxyethyl]oxan-2-yl]ethanone |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC[C@H](C(C)=O)O[C@@H]1CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H52O4Si2/c1-12-30(13-2,14-3)29-25(11)17-15-23(22(10)26)28-24(25)16-18-27-31(19(4)5,20(6)7)21(8)9/h19-21,23-24H,12-18H2,1-11H3/t23-,24-,25-/m1/s1 |
| InChIKey | SMHXPGCXYKKSFJ-UBFVSLLYSA-N |
| XLogP | 7.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.86 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|