C21H44O4Si2 — CID 10598024
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-dimethyloxiran-2-yl]butan-2-one (PubChem CID 10598024) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-dimethyloxiran-2-yl]butan-2-one.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-dimethyloxiran-2-yl]butan-2-one |
|---|---|
| PubChem CID | 10598024 |
| Molecular Formula | C21H44O4Si2 |
| Molecular Weight | 416.75 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,3-dimethyloxiran-2-yl]butan-2-one |
| SMILES | CC(=O)[C@H](C[C@]1(CO[Si](C)(C)C(C)(C)C)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O4Si2/c1-16(22)17(24-27(12,13)19(5,6)7)14-21(20(8,9)25-21)15-23-26(10,11)18(2,3)4/h17H,14-15H2,1-13H3/t17-,21+/m0/s1 |
| InChIKey | WBPFYICEBZQPJD-LAUBAEHRSA-N |
| XLogP | 5.93 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.75 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|