C21H44O5Si2 — CID 11797007
(3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]butan-2-one (PubChem CID 11797007) has the molecular formula C21H44O5Si2 and a molecular weight of 432.75 g/mol. Its IUPAC name is (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]butan-2-one.
| Compound Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]butan-2-one |
|---|---|
| PubChem CID | 11797007 |
| Molecular Formula | C21H44O5Si2 |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (3S)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]butan-2-one |
| SMILES | CC(=O)[C@H](C[C@]1(COCOCC[Si](C)(C)C)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44O5Si2/c1-17(22)18(25-28(10,11)19(2,3)4)14-21(20(5,6)26-21)15-24-16-23-12-13-27(7,8)9/h18H,12-16H2,1-11H3/t18-,21+/m0/s1 |
| InChIKey | CHVMWJYFEGWJGN-GHTZIAJQSA-N |
| XLogP | 5.23 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|