C23H48O6Si2 — CID 10648278
propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]propanoate (PubChem CID 10648278) has the molecular formula C23H48O6Si2 and a molecular weight of 476.80 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]propanoate.
| Compound Name | propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 10648278 |
| Molecular Formula | C23H48O6Si2 |
| Molecular Weight | 476.80 g/mol |
| Exact Mass | 476.30 |
| IUPAC Name | propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-3,3-dimethyl-2-(2-trimethylsilylethoxymethoxymethyl)oxiran-2-yl]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C[C@]1(COCOCC[Si](C)(C)C)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O6Si2/c1-18(2)27-20(24)19(28-31(11,12)21(3,4)5)15-23(22(6,7)29-23)16-26-17-25-13-14-30(8,9)10/h18-19H,13-17H2,1-12H3/t19-,23+/m0/s1 |
| InChIKey | BHXLNTMYVWHUOE-WMZHIEFXSA-N |
| XLogP | 5.59 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|