C17H34O5Si — CID 11791903
propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]propanoate (PubChem CID 11791903) has the molecular formula C17H34O5Si and a molecular weight of 346.54 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]propanoate.
| Compound Name | propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 11791903 |
| Molecular Formula | C17H34O5Si |
| Molecular Weight | 346.54 g/mol |
| Exact Mass | 346.22 |
| IUPAC Name | propan-2-yl (2S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(2R)-2-(hydroxymethyl)-3,3-dimethyloxiran-2-yl]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C[C@]1(CO)OC1(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O5Si/c1-12(2)20-14(19)13(21-23(8,9)15(3,4)5)10-17(11-18)16(6,7)22-17/h12-13,18H,10-11H2,1-9H3/t13-,17+/m0/s1 |
| InChIKey | IWOUXZOEBYLKGV-SUMWQHHRSA-N |
| XLogP | 3.26 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|