C18H36O6Si — CID 10992445
ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-4-methyl-8-oxononanoate (PubChem CID 10992445) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-4-methyl-8-oxononanoate.
| Compound Name | ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-4-methyl-8-oxononanoate |
|---|---|
| PubChem CID | 10992445 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | ethyl (7S)-7-[tert-butyl(dimethyl)silyl]oxy-4,5-dihydroxy-4-methyl-8-oxononanoate |
| SMILES | CCOC(=O)CCC(C)(O)C(O)C[C@H](O[Si](C)(C)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C18H36O6Si/c1-9-23-16(21)10-11-18(6,22)15(20)12-14(13(2)19)24-25(7,8)17(3,4)5/h14-15,20,22H,9-12H2,1-8H3/t14-,15?,18?/m0/s1 |
| InChIKey | MQBKCBFVRIFBKX-SYJJWHGVSA-N |
| XLogP | 2.81 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|