C20H38O6Si — CID 25170445
methyl (2S,3R)-3-[(2R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3-dimethyl-6-oxooctyl]oxirane-2-carboxylate (PubChem CID 25170445) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is methyl (2S,3R)-3-[(2R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3-dimethyl-6-oxooctyl]oxirane-2-carboxylate.
| Compound Name | methyl (2S,3R)-3-[(2R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3-dimethyl-6-oxooctyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 25170445 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | methyl (2S,3R)-3-[(2R,4R)-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3,3-dimethyl-6-oxooctyl]oxirane-2-carboxylate |
| SMILES | CCC(=O)C[C@@H](O)C(C)(C)[C@@H](C[C@H]1O[C@@H]1C(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O6Si/c1-10-13(21)11-15(22)20(5,6)16(26-27(8,9)19(2,3)4)12-14-17(25-14)18(23)24-7/h14-17,22H,10-12H2,1-9H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | KPOACJBKBMKEOC-VQHPVUNQSA-N |
| XLogP | 3.46 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|