C16H32O5Si — CID 59127504
ethyl (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-3-ethyloxirane-2-carboxylate (PubChem CID 59127504) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is ethyl (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-3-ethyloxirane-2-carboxylate.
| Compound Name | ethyl (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-3-ethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 59127504 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | ethyl (2R,3R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropyl]-3-ethyloxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1([C@@H](CCO)O[Si](C)(C)C(C)(C)C)O[C@@H]1CC |
| InChI | InChI=1S/C16H32O5Si/c1-8-12-16(20-12,14(18)19-9-2)13(10-11-17)21-22(6,7)15(3,4)5/h12-13,17H,8-11H2,1-7H3/t12-,13-,16-/m1/s1 |
| InChIKey | RNTHIDWHQXOPCB-XJKCOSOUSA-N |
| XLogP | 2.87 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|