C30H60O7Si — CID 162419089
[(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] (2R)-oxolane-2-carboxylate (PubChem CID 162419089) has the molecular formula C30H60O7Si and a molecular weight of 560.89 g/mol. Its IUPAC name is [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] (2R)-oxolane-2-carboxylate.
| Compound Name | [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] (2R)-oxolane-2-carboxylate |
|---|---|
| PubChem CID | 162419089 |
| Molecular Formula | C30H60O7Si |
| Molecular Weight | 560.89 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | [(2R,3R,4S,5R,8S,9S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-1-hydroxy-3,9-dimethoxy-2,4,8,12-tetramethyltridecan-5-yl] (2R)-oxolane-2-carboxylate |
| SMILES | CO[C@@H]([C@@H](C)[C@@H](CC[C@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC)OC(=O)[C@H]1CCCO1)[C@H](C)CO |
| InChI | InChI=1S/C30H60O7Si/c1-20(2)26(37-38(11,12)30(6,7)8)18-27(33-9)21(3)15-16-24(23(5)28(34-10)22(4)19-31)36-29(32)25-14-13-17-35-25/h20-28,31H,13-19H2,1-12H3/t21-,22+,23-,24+,25+,26-,27-,28+/m0/s1 |
| InChIKey | OYNIYYMONUNIQI-PJHAEWMWSA-N |
| XLogP | 6.22 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|