C27H56O7Si2 — CID 59916227
[(2R,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 59916227) has the molecular formula C27H56O7Si2 and a molecular weight of 548.91 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59916227 |
| Molecular Formula | C27H56O7Si2 |
| Molecular Weight | 548.91 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@@H](CO)[C@H](COC(=O)C(C)(C)C)O[C@@H]1C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H56O7Si2/c1-25(2,3)24(29)31-18-22-20(16-28)23(30-10)21(33-22)15-19(34-36(13,14)27(7,8)9)17-32-35(11,12)26(4,5)6/h19-23,28H,15-18H2,1-14H3/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | XVHUGOZVZVHHAG-USWKJHDZSA-N |
| XLogP | 5.77 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.91 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|