C23H43F3O6Si — CID 59916221
2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 59916221) has the molecular formula C23H43F3O6Si and a molecular weight of 500.67 g/mol. Its IUPAC name is 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59916221 |
| Molecular Formula | C23H43F3O6Si |
| Molecular Weight | 500.67 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | 2-[(2S,3S,4R,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutyl]-3-(hydroxymethyl)-4-methoxyoxolan-2-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CO[C@@H]1[C@@H](CO)[C@H](CCOC(=O)C(C)(C)C)O[C@@H]1CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C23H43F3O6Si/c1-21(2,3)20(28)30-13-12-16-15(14-27)19(29-7)17(31-16)10-11-18(23(24,25)26)32-33(8,9)22(4,5)6/h15-19,27H,10-14H2,1-9H3/t15-,16-,17+,18?,19+/m0/s1 |
| InChIKey | WWQBLJSXGPOCFW-QRXAFDDPSA-N |
| XLogP | 5.09 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|