C19H40O5Si — CID 14061493
[(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2,4-dimethylhexyl] 2,2-dimethylpropanoate (PubChem CID 14061493) has the molecular formula C19H40O5Si and a molecular weight of 376.61 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2,4-dimethylhexyl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2,4-dimethylhexyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 14061493 |
| Molecular Formula | C19H40O5Si |
| Molecular Weight | 376.61 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(2S,3R,4S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5,6-dihydroxy-2,4-dimethylhexyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)COC(=O)C(C)(C)C)[C@@H](O)CO |
| InChI | InChI=1S/C19H40O5Si/c1-13(12-23-17(22)18(3,4)5)16(14(2)15(21)11-20)24-25(9,10)19(6,7)8/h13-16,20-21H,11-12H2,1-10H3/t13-,14-,15-,16+/m0/s1 |
| InChIKey | GGIDGGPPEQDHFX-YHUYYLMFSA-N |
| XLogP | 3.59 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|