C17H36O4Si — CID 162397929
[(3S)-5-hydroxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate (PubChem CID 162397929) has the molecular formula C17H36O4Si and a molecular weight of 332.56 g/mol. Its IUPAC name is [(3S)-5-hydroxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S)-5-hydroxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 162397929 |
| Molecular Formula | C17H36O4Si |
| Molecular Weight | 332.56 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [(3S)-5-hydroxy-2-methyl-3-triethylsilyloxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](CCO)C(C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H36O4Si/c1-8-22(9-2,10-3)21-15(11-12-18)14(4)13-20-16(19)17(5,6)7/h14-15,18H,8-13H2,1-7H3/t14?,15-/m0/s1 |
| InChIKey | JVJSJFKJKQLVCB-LOACHALJSA-N |
| XLogP | 3.98 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|