C18H38O4Si — CID 10472836
tert-butyl (2S,3R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-hydroxypentanoate (PubChem CID 10472836) has the molecular formula C18H38O4Si and a molecular weight of 346.58 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-hydroxypentanoate.
| Compound Name | tert-butyl (2S,3R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-hydroxypentanoate |
|---|---|
| PubChem CID | 10472836 |
| Molecular Formula | C18H38O4Si |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | tert-butyl (2S,3R)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-hydroxypentanoate |
| SMILES | CC[C@@H](O)[C@H](CCCO[Si](C)(C)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H38O4Si/c1-10-15(19)14(16(20)22-17(2,3)4)12-11-13-21-23(8,9)18(5,6)7/h14-15,19H,10-13H2,1-9H3/t14-,15+/m0/s1 |
| InChIKey | XWWCFTSAGVIKOL-LSDHHAIUSA-N |
| XLogP | 4.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|