C24H50O8Si2 — CID 11005867
diethyl (2S,3R,4S,5R,6S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxy-4-methylheptanedioate (PubChem CID 11005867) has the molecular formula C24H50O8Si2 and a molecular weight of 522.83 g/mol. Its IUPAC name is diethyl (2S,3R,4S,5R,6S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxy-4-methylheptanedioate.
| Compound Name | diethyl (2S,3R,4S,5R,6S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxy-4-methylheptanedioate |
|---|---|
| PubChem CID | 11005867 |
| Molecular Formula | C24H50O8Si2 |
| Molecular Weight | 522.83 g/mol |
| Exact Mass | 522.30 |
| IUPAC Name | diethyl (2S,3R,4S,5R,6S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-5,6-dihydroxy-4-methylheptanedioate |
| SMILES | CCOC(=O)[C@@H](O)[C@H](O)[C@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C24H50O8Si2/c1-14-29-21(27)18(26)17(25)16(3)19(31-33(10,11)23(4,5)6)20(22(28)30-15-2)32-34(12,13)24(7,8)9/h16-20,25-26H,14-15H2,1-13H3/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | CTGXXEHOJAVODC-YHDCXSKOSA-N |
| XLogP | 4.25 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.83 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|